jaden9904 jaden9904

04-02-2020
Biology

contestada

Which is not a source of carbon dioxide gas?
A humans
B machines
C plants
D factories

Respuesta :

mariahahaha mariahahaha

04-02-2020

Answer is
C. Plants

Answer Link

ttamya100 ttamya100

04-02-2020

The answer is C, plants

Answer Link

Otras preguntas

Does Macbeth, Malcolm, Macduff, Lady Macduff and Ross have attitudes that are realistic? Why or why not

Find the slope of the line.4/3-4/3-3/43/4

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

can somebody tell me when is ps5 releasing???

Applying the median-voter model and assuming that there are equal numbers of voters supporting each stadium, we would expect:________ a. stadium C to be built,

One of your friends tells you, "I didn’t like the environmental-awareness presentation today. First of all, it was too long, not to mention the person that gave

What three things are required for a fire to start?

Two boxes can hold the same amount of sand. Box 1 is 1/4 filled and box 2 is 2/3 filled. If the sand in box2 is poured into box 1, what is the fraction of box 1

Please answer answer question now

What is a healthy way to cope with distress