kingkahri9846 kingkahri9846
  • 01-08-2017
  • Biology
contestada

The outer boundary of a human cell is the

Respuesta :

kikiki234 kikiki234
  • 01-08-2017
Cell membrane (remember animals don't have cell walls)
Answer Link

Otras preguntas

0 = -12 + 4y - 3x whats the slope
The Agency for Healthcare Research and Quality (AHRQ) was established to:​________.a) ​improve health care delivery. b) ​provide uniform guidelines in mental he
Based on the criteria used by Bureau of labor statics,Identify each person status as employed,unemployed, not in labor force ,not in civilion labor force but st
The web development team is having difficulty connecting by ssh to your local web server, and you notice the proper rule is missing from the firewall. What port
Examine some of the difficulties in the financial system in Ghana and how it has been addressed?
Solve for x: 2(10-2x) = 4(3x + 1). Write your answer as a fraction.
The data represents the number of runs allowed by 8 college softball pitchers. {18, 49, 38, 41, 33, 44, 42, 22}
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Choose the function whose graph is given by
Think of a better and more effective idea to dispose garbage. Write a report.​